ChemNet > CAS > 78902-09-7 Phthalimidoacetaldehyde diethyl acetal
78902-09-7 Phthalimidoacetaldehyde diethyl acetal
| product Name |
Phthalimidoacetaldehyde diethyl acetal |
| Synonyms |
LABOTEST-BB LT00454122; 2-PHTHALIMIDOACETALDEHYDE DIETHYL ACETAL; N-(2,2-DIETHOXYETHYL)PHTHALIMIDE; 2-(2,2-diethoxyethyl)-1H-isoindole-1,3(2H)-dione; 2-(Phthalimido)acetaldehyde diethylacetal; 2-(2,2-Diethoxyethyl)isoindoline-1,3-dione |
| Molecular Formula |
C14H17NO4 |
| Molecular Weight |
263.2891 |
| InChI |
InChI=1/C14H17NO4/c1-3-18-12(19-4-2)9-15-13(16)10-7-5-6-8-11(10)14(15)17/h5-8,12H,3-4,9H2,1-2H3 |
| CAS Registry Number |
78902-09-7 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Melting point |
72-74℃ |
| Boiling point |
372.3°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
179°C |
| Vapour Pressur |
9.7E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
