ChemNet > CAS > 89074-92-0 N,N-Diethyl-m-toluidine hydrochloride
89074-92-0 N,N-Diethyl-m-toluidine hydrochloride
| product Name |
N,N-Diethyl-m-toluidine hydrochloride |
| Synonyms |
N,N-Diethyl-3-methylaniline hydrochloride; N,N-diethyl-3-methylaniline hydrochloride (1:1) |
| Molecular Formula |
C11H18ClN |
| Molecular Weight |
199.7203 |
| InChI |
InChI=1/C11H17N.ClH/c1-4-12(5-2)11-8-6-7-10(3)9-11;/h6-9H,4-5H2,1-3H3;1H |
| CAS Registry Number |
89074-92-0 |
| Molecular Structure |
|
| Boiling point |
243.6°C at 760 mmHg |
| Flash point |
98.4°C |
| Vapour Pressur |
0.0317mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
