ChemNet > CAS > 89479-66-3 3-methyl-5-phenyl-4-isoxazolecarbaldehyde
89479-66-3 3-methyl-5-phenyl-4-isoxazolecarbaldehyde
product Name |
3-methyl-5-phenyl-4-isoxazolecarbaldehyde |
Synonyms |
3-methyl-5-phenylisoxazole-4-carbaldehyde |
Molecular Formula |
C11H9NO2 |
Molecular Weight |
187.1947 |
InChI |
InChI=1/C11H9NO2/c1-8-10(7-13)11(14-12-8)9-5-3-2-4-6-9/h2-7H,1H3 |
CAS Registry Number |
89479-66-3 |
Molecular Structure |
|
Density |
1.179g/cm3 |
Melting point |
89℃ |
Boiling point |
357.2°C at 760 mmHg |
Refractive index |
1.58 |
Flash point |
169.8°C |
Vapour Pressur |
2.78E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|