ChemNet > CAS > 92636-36-7 1-(4-Iodophenyl)pyrrole
92636-36-7 1-(4-Iodophenyl)pyrrole
product Name |
1-(4-Iodophenyl)pyrrole |
Synonyms |
1-(4-iodophenyl)-1H-pyrrole |
Molecular Formula |
C10H8IN |
Molecular Weight |
269.0817 |
InChI |
InChI=1/C10H8IN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
CAS Registry Number |
92636-36-7 |
Molecular Structure |
|
Density |
1.63g/cm3 |
Melting point |
131-133℃ |
Boiling point |
302°C at 760 mmHg |
Refractive index |
1.65 |
Flash point |
136.4°C |
Vapour Pressur |
0.00182mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|