ChemNet > CAS > 933-78-8 2,3,5-Trichlorophenol
933-78-8 2,3,5-Trichlorophenol
product Name |
2,3,5-Trichlorophenol |
Molecular Formula |
C6H3Cl3O |
Molecular Weight |
197.4464 |
InChI |
InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
CAS Registry Number |
933-78-8 |
EINECS |
213-272-2 |
Molecular Structure |
|
Density |
1.596g/cm3 |
Melting point |
57-60℃ |
Boiling point |
250.2°C at 760 mmHg |
Refractive index |
1.608 |
Flash point |
105.1°C |
Vapour Pressur |
0.0139mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|