ChemNet > CAS > 132-86-5 1,3-Dihydroxynaphthalene
132-86-5 1,3-Dihydroxynaphthalene
| Ονομασία του προϊόντος |
1,3-Dihydroxynaphthalene |
| Συνώνυμα |
1,3-Naphthalenediol; Naphthoresorcinol; naphtharesorcinol; NAPHTORESORCINE; naphthalene-1,3-diol |
| MF |
C10H8O2 |
| Μοριακό βάρος |
160.1693 |
| InChI |
InChI=1/C10H8O2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,11-12H |
| CAS ΟΧΙ |
132-86-5 |
| EINECS |
205-079-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.33g/cm3 |
| Σημείο τήξης |
123-126℃ |
| Σημείο βρασμού |
361.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.725 |
| Σημείο ανάφλεξης |
185.5°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
