ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
Ονομασία του προϊόντος |
1-Piperidinethiocarboxamide |
Συνώνυμα |
piperidine-1-carbothioamide |
MF |
C6H12N2S |
Μοριακό βάρος |
144.2379 |
InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
CAS ΟΧΙ |
14294-09-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.165g/cm3 |
Σημείο βρασμού |
237.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.593 |
Σημείο ανάφλεξης |
97.3°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/22:Harmful by inhalation and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|