ChemNet > CAS > 1475-12-3 1-(2,5-Dichlorophenyl)ethanol
1475-12-3 1-(2,5-Dichlorophenyl)ethanol
| Ονομασία του προϊόντος |
1-(2,5-Dichlorophenyl)ethanol |
| Συνώνυμα |
2,5-Dichloro-alpha-methylbenzyl alcohol~2,5-Dichlorophenyl methyl carbinol; 2,5-Dichlorophenyl Ethanol |
| MF |
C8H8Cl2O |
| Μοριακό βάρος |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3 |
| CAS ΟΧΙ |
1475-12-3 |
| EINECS |
216-018-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.323g/cm3 |
| Σημείο βρασμού |
257.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.566 |
| Σημείο ανάφλεξης |
112.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
