ChemNet > CAS > 1483-27-8 2,5-Dimethoxythiophenol
1483-27-8 2,5-Dimethoxythiophenol
| Ονομασία του προϊόντος |
2,5-Dimethoxythiophenol |
| Συνώνυμα |
2,5-Dimethoxybenzenethiol |
| MF |
C8H10O2S |
| Μοριακό βάρος |
170.2288 |
| InChI |
InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
| CAS ΟΧΙ |
1483-27-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.134g/cm3 |
| Σημείο βρασμού |
278.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.549 |
| Σημείο ανάφλεξης |
122.4°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
