ChemNet > CAS > 14922-36-2 4-Nitrophenylglyoxylic acid
14922-36-2 4-Nitrophenylglyoxylic acid
| Ονομασία του προϊόντος |
4-Nitrophenylglyoxylic acid |
| Συνώνυμα |
4-Nitrobenzoylformic acid; (4-nitrophenyl)(oxo)acetic acid |
| MF |
C8H5NO5 |
| Μοριακό βάρος |
195.129 |
| InChI |
InChI=1/C8H5NO5/c10-7(8(11)12)5-1-3-6(4-2-5)9(13)14/h1-4H,(H,11,12) |
| CAS ΟΧΙ |
14922-36-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.531g/cm3 |
| Σημείο βρασμού |
381.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.613 |
| Σημείο ανάφλεξης |
173.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
