ChemNet > CAS > 1633-44-9 3,4-pyridinedicarbonitrile
1633-44-9 3,4-pyridinedicarbonitrile
| Ονομασία του προϊόντος |
3,4-pyridinedicarbonitrile |
| Συνώνυμα |
3,4-pyridinedicarbonitrile; PYRIDINE-3,4-DICARBONITRILE |
| MF |
C7H3N3 |
| Μοριακό βάρος |
129.1188 |
| InChI |
InChI=1/C7H3N3/c8-3-6-1-2-10-5-7(6)4-9/h1-2,5H |
| CAS ΟΧΙ |
1633-44-9 |
| EINECS |
216-645-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.25g/cm3 |
| Σημείο τήξης |
79-81℃ |
| Σημείο βρασμού |
310.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.567 |
| Σημείο ανάφλεξης |
112.4°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
