ChemNet > CAS > 175135-23-6 2-(n-Pentylthio)nicotinic acid
175135-23-6 2-(n-Pentylthio)nicotinic acid
| Ονομασία του προϊόντος |
2-(n-Pentylthio)nicotinic acid |
| Συνώνυμα |
2-(n-Amylmercapto)nicotinic acid~2-(n-Amylthio)nicotinic acid~2-(n-Pentylthio)pyridine-3-carboxylic acid; 2-(n-Amylthio)nicotinic acid; 2-(pentylsulfanyl)pyridine-3-carboxylic acid; 2-(pentylsulfanyl)pyridine-3-carboxylate |
| MF |
C11H14NO2S |
| Μοριακό βάρος |
224.2999 |
| InChI |
InChI=1/C11H15NO2S/c1-2-3-4-8-15-10-9(11(13)14)6-5-7-12-10/h5-7H,2-4,8H2,1H3,(H,13,14)/p-1 |
| CAS ΟΧΙ |
175135-23-6 |
| Μοριακή δομή |
|
| Σημείο τήξης |
118℃ |
| Σημείο βρασμού |
372.6°C at 760 mmHg |
| Σημείο ανάφλεξης |
179.1°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
