ChemNet > CAS > 19179-36-3 3,5-Dihydroxybenzonitrile
19179-36-3 3,5-Dihydroxybenzonitrile
| Ονομασία του προϊόντος |
3,5-Dihydroxybenzonitrile |
| MF |
C7H5NO2 |
| Μοριακό βάρος |
135.1201 |
| InChI |
InChI=1/C7H5NO2/c8-4-5-1-6(9)3-7(10)2-5/h1-3,9-10H |
| CAS ΟΧΙ |
19179-36-3 |
| EINECS |
242-859-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.42g/cm3 |
| Σημείο βρασμού |
336.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.647 |
| Σημείο ανάφλεξης |
157.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
