ChemNet > CAS > 20514-41-4 2,5-Dimethyl-2,4-hexadienedioic Acid
20514-41-4 2,5-Dimethyl-2,4-hexadienedioic Acid
| Ονομασία του προϊόντος |
2,5-Dimethyl-2,4-hexadienedioic Acid |
| Συνώνυμα |
a,a-Dimethylmuconic acid; 2,5-dimethylhexa-2,4-dienedioic acid; (2E,4E)-2,5-dimethylhexa-2,4-dienedioic acid |
| MF |
C8H10O4 |
| Μοριακό βάρος |
170.1626 |
| InChI |
InChI=1/C8H10O4/c1-5(7(9)10)3-4-6(2)8(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/b5-3+,6-4+ |
| CAS ΟΧΙ |
20514-41-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.245g/cm3 |
| Σημείο βρασμού |
351°C at 760 mmHg |
| Δείκτης διάθλασης |
1.527 |
| Σημείο ανάφλεξης |
180.3°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
