ChemNet > CAS > 2150-43-8 Methyl 3,4-dihydroxybenzoate
2150-43-8 Methyl 3,4-dihydroxybenzoate
Ονομασία του προϊόντος |
Methyl 3,4-dihydroxybenzoate |
Συνώνυμα |
3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
MF |
C8H8O4 |
Μοριακό βάρος |
168.1467 |
InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
CAS ΟΧΙ |
2150-43-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.354g/cm3 |
Σημείο βρασμού |
351.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.587 |
Σημείο ανάφλεξης |
148.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|