ChemNet > CAS > 26475-66-1 4-Benzylthiomorpholine 1,1-Dioxide
26475-66-1 4-Benzylthiomorpholine 1,1-Dioxide
Ονομασία του προϊόντος |
4-Benzylthiomorpholine 1,1-Dioxide |
Συνώνυμα |
4-Benzylthiomorpholine 1,1-Dioxide; thiomorpholine, 4-(phenylmethyl)-, 1,1-dioxide |
MF |
C11H15NO2S |
Μοριακό βάρος |
225.3073 |
InChI |
InChI=1/C11H15NO2S/c13-15(14)8-6-12(7-9-15)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
CAS ΟΧΙ |
26475-66-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.235g/cm3 |
Σημείο τήξης |
83℃ |
Σημείο βρασμού |
397.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.578 |
Σημείο ανάφλεξης |
194.4°C |
Σύμβολα επικινδυνότητας |
C:Corrosive;
|
Κινδύνου Κώδικες |
R34:Causes burns.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|