ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
Ονομασία του προϊόντος |
5-methyl-2-nitrobenzoic acid |
Συνώνυμα |
6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
MF |
C8H7NO4 |
Μοριακό βάρος |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
CAS ΟΧΙ |
3113-72-2 |
EINECS |
221-481-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.392g/cm3 |
Σημείο τήξης |
134-136℃ |
Σημείο βρασμού |
367.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.6 |
Σημείο ανάφλεξης |
166.8°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|