ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
| Ονομασία του προϊόντος |
5-methyl-2-nitrobenzoic acid |
| Συνώνυμα |
6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
| MF |
C8H7NO4 |
| Μοριακό βάρος |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| CAS ΟΧΙ |
3113-72-2 |
| EINECS |
221-481-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.392g/cm3 |
| Σημείο τήξης |
134-136℃ |
| Σημείο βρασμού |
367.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.6 |
| Σημείο ανάφλεξης |
166.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
