ChemNet > CAS > 3141-25-1 2,3,4-Tribromothiophene
3141-25-1 2,3,4-Tribromothiophene
| Ονομασία του προϊόντος |
2,3,4-Tribromothiophene |
| MF |
C4HBr3S |
| Μοριακό βάρος |
320.8277 |
| InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
| CAS ΟΧΙ |
3141-25-1 |
| EINECS |
221-545-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.516g/cm3 |
| Σημείο βρασμού |
277.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.671 |
| Σημείο ανάφλεξης |
121.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
