ChemNet > CAS > 50670-83-2 5-acetamino-2-aminobenzoic acid
50670-83-2 5-acetamino-2-aminobenzoic acid
Ονομασία του προϊόντος |
5-acetamino-2-aminobenzoic acid |
Συνώνυμα |
2-Amino-5-Acetamino Benzoic Acid; 5-acetamide-2-amino-benzoic acid; 5-(acetylamino)-2-aminobenzoic acid; 5-Acetylamino anthranilic acid; 5-Acetamidoanthranilic acid |
MF |
C9H10N2O3 |
Μοριακό βάρος |
194.1873 |
InChI |
InChI=1/C9H10N2O3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,10H2,1H3,(H,11,12)(H,13,14) |
CAS ΟΧΙ |
50670-83-2 |
EINECS |
256-702-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.414g/cm3 |
Σημείο βρασμού |
365.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.676 |
Σημείο ανάφλεξης |
175.1°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|