ChemNet > CAS > 111-12-6;53073-28-2 Methyl 2-octynoate
111-12-6;53073-28-2 Methyl 2-octynoate
| Ονομασία του προϊόντος |
Methyl 2-octynoate |
| Συνώνυμα |
Methyl heptine carbonate; 2-Octynoic acid, methyl ester; FEMA No. 2729; Folione; Methyl 2-octinate; Methyl 2-octynate; Methyl hept-1-yne-1-carboxylate; Methyl pentylacetylenecarboxylate; Vert de violette, artificial; Methyl oct-2-ynoate |
| MF |
C9H14O2 |
| Μοριακό βάρος |
154.2063 |
| InChI |
InChI=1/C9H14O2/c1-3-4-5-6-7-8-9(10)11-2/h3-6H2,1-2H3 |
| CAS ΟΧΙ |
111-12-6;53073-28-2 |
| EINECS |
203-836-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.94g/cm3 |
| Σημείο βρασμού |
218.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.443 |
| Σημείο ανάφλεξης |
88.9°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
