ChemNet > CAS > 54585-47-6 4,6-Dimethyl-2-mercaptonicotinonitrile
54585-47-6 4,6-Dimethyl-2-mercaptonicotinonitrile
| Ονομασία του προϊόντος |
4,6-Dimethyl-2-mercaptonicotinonitrile |
| Συνώνυμα |
5-Cyano-6-mercapto-2,4-lutidine~4,6-Dimethyl-2-mercaptonicotinonitrile~4,6-Dimethyl-2-mercaptopyridine-3-carbonitrile; 4,6-dimethyl-2-thioxo-1,2-dihydropyridine-3-carbonitrile |
| MF |
C8H8N2S |
| Μοριακό βάρος |
164.2275 |
| InChI |
InChI=1/C8H8N2S/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,1-2H3,(H,10,11) |
| CAS ΟΧΙ |
54585-47-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.21g/cm3 |
| Σημείο βρασμού |
249.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.608 |
| Σημείο ανάφλεξης |
104.9°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
