ChemNet > CAS > 5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
5743-34-0 D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1)
Ονομασία του προϊόντος |
D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1) |
Συνώνυμα |
Calcium borogluconate; AI3-52160; D-Gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1); calcium bis{2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoic acid |
MF |
C6H11BO8 |
Μοριακό βάρος |
221.9577 |
InChI |
InChI=1/C6H11BO8/c8-1-2-5(15-7(13)14-2)3(9)4(10)6(11)12/h2-5,8-10,13H,1H2,(H,11,12) |
CAS ΟΧΙ |
5743-34-0 |
EINECS |
227-264-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.68g/cm3 |
Σημείο βρασμού |
530.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.558 |
Σημείο ανάφλεξης |
274.9°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|