ChemNet > CAS > 59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
| Ονομασία του προϊόντος |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
| MF |
C4H3ClN2OS |
| Μοριακό βάρος |
162.5974 |
| InChI |
InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
| CAS ΟΧΙ |
59944-65-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.504g/cm3 |
| Σημείο βρασμού |
239.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.578 |
| Σημείο ανάφλεξης |
98.9°C |
| Σύμβολα επικινδυνότητας |
 C:Corrosive;
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
