ChemNet > CAS > 6138-90-5 Geranyl Bromide
6138-90-5 Geranyl Bromide
Ονομασία του προϊόντος |
Geranyl Bromide |
Συνώνυμα |
3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
MF |
C10H17Br |
Μοριακό βάρος |
217.146 |
InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
CAS ΟΧΙ |
6138-90-5 |
EINECS |
228-123-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.121g/cm3 |
Σημείο βρασμού |
227.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.489 |
Σημείο ανάφλεξης |
95°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|