ChemNet > CAS > 621-51-2 3-Ethoxybenzoic acid
621-51-2 3-Ethoxybenzoic acid
| Ονομασία του προϊόντος |
3-Ethoxybenzoic acid |
| Συνώνυμα |
3-Ethoxy Benzoic Acid |
| MF |
C9H10O3 |
| Μοριακό βάρος |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| CAS ΟΧΙ |
621-51-2 |
| EINECS |
210-690-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.166g/cm3 |
| Σημείο τήξης |
136-140℃ |
| Σημείο βρασμού |
305.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.537 |
| Σημείο ανάφλεξης |
124.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
