ChemNet > CAS > 63429-99-2 5-Chloro-2-methoxyphenyl isothiocyanate
63429-99-2 5-Chloro-2-methoxyphenyl isothiocyanate
| Ονομασία του προϊόντος |
5-Chloro-2-methoxyphenyl isothiocyanate |
| Συνώνυμα |
5-Chloro-2-methoxyisothiocyanatobenzene; 4-chloro-2-isothiocyanato-1-methoxybenzene |
| MF |
C8H6ClNOS |
| Μοριακό βάρος |
199.6573 |
| InChI |
InChI=1/C8H6ClNOS/c1-11-8-3-2-6(9)4-7(8)10-5-12/h2-4H,1H3 |
| CAS ΟΧΙ |
63429-99-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.23g/cm3 |
| Σημείο τήξης |
56℃ |
| Σημείο βρασμού |
323.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.572 |
| Σημείο ανάφλεξης |
149.5°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
