CAS No: 68411-46-1, Chemical Name: Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
the physical and chemical property of 68411-46-1, Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene is provided by ChemNet.com
ChemNet > CAS > 68411-46-1 Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
68411-46-1 Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
| Ονομασία του προϊόντος |
Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene |
| Συνώνυμα |
N-phenylaniline - 2,4,4-trimethylpent-1-ene (1:1); Antioxidant 5057; Irganox 5057; Quantox-557; Alkyl diphenylamine; AN 5057; N-Phenylbenzenamine reactioin products with 2,4,4-trimethylpentene |
| MF |
C20H27N |
| Μοριακό βάρος |
281.4351 |
| InChI |
InChI=1/C12H11N.C8H16/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2)6-8(3,4)5/h1-10,13H;1,6H2,2-5H3 |
| CAS ΟΧΙ |
68411-46-1 |
| EINECS |
270-128-1 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
302°C at 760 mmHg |
| Σημείο ανάφλεξης |
152.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
|
|
