ChemNet > CAS > 75898-90-7 Inamrinone lactate
75898-90-7 Inamrinone lactate
Ονομασία του προϊόντος |
Inamrinone lactate |
Συνώνυμα |
3-Hydroxypropanoic acid compd. with 5-amino-(3,4'-bipyridin)-6(1H)-one; Amrinone lactate; UNII-I229274Y5B; (3,4'-Bipyridin)-6(1H)-one, 5-amino-, 3-hydroxypropanoate; Propanoic acid, 3-hydroxy-, compd. with 5-amino-(3,4'-bipyridin)-6(1H)-one; 3-hydroxypropanoic acid - 5-amino-3,4'-bipyridin-6(1H)-one (1:1); 2-hydroxypropanoic acid - 5-amino-3,4'-bipyridin-6(1H)-one (1:1) |
MF |
C13H15N3O4 |
Μοριακό βάρος |
277.2759 |
InChI |
InChI=1/C10H9N3O.C3H6O3/c11-9-5-8(6-13-10(9)14)7-1-3-12-4-2-7;1-2(4)3(5)6/h1-6H,11H2,(H,13,14);2,4H,1H3,(H,5,6) |
CAS ΟΧΙ |
75898-90-7 |
Μοριακή δομή |
|
Σημείο βρασμού |
451.5°C at 760 mmHg |
Σημείο ανάφλεξης |
226.9°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|