ChemNet > CAS > 85715-60-2 Ethylenediaminetetraacetic acid, trisodiumsalt hydrate
85715-60-2 Ethylenediaminetetraacetic acid, trisodiumsalt hydrate
| Ονομασία του προϊόντος |
Ethylenediaminetetraacetic acid, trisodiumsalt hydrate |
| Συνώνυμα |
EDTA, trisodium salt hydrate; Ethylenediaminetetraacetic acid, trisodium salt hydrate |
| MF |
C10H14N2Na3O9 |
| Μοριακό βάρος |
375.196 |
| InChI |
InChI=1/C10H16N2O8.3Na.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;1H2/q;3*+1;/p-4 |
| CAS ΟΧΙ |
85715-60-2 |
| Μοριακή δομή |
|
| Σημείο τήξης |
300℃ |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
