ChemNet > CAS > 86454-13-9 2-hydroxy-6-methylisonicotinic acid
86454-13-9 2-hydroxy-6-methylisonicotinic acid
Ονομασία του προϊόντος |
2-hydroxy-6-methylisonicotinic acid |
Συνώνυμα |
6-methyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid; 2-Hydroxy-6-Methylpyridine-4-Carboxylic Acid |
MF |
C7H7NO3 |
Μοριακό βάρος |
153.1354 |
InChI |
InChI=1/C7H7NO3/c1-4-2-5(7(10)11)3-6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) |
CAS ΟΧΙ |
86454-13-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.345g/cm3 |
Σημείο τήξης |
330℃ |
Σημείο βρασμού |
371.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.555 |
Σημείο ανάφλεξης |
178.3°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|