ChemNet > CAS > 1078-05-3 4-Nitronicotinic acid N-oxide
1078-05-3 4-Nitronicotinic acid N-oxide
| termék neve |
4-Nitronicotinic acid N-oxide |
| Szinonimák |
4-Nitropyridine-3-carboxylic acid N-oxide; 4-nitropyridine-3-carboxylic acid 1-oxide |
| MF |
C6H4N2O5 |
| Molekulatömeg |
184.1064 |
| InChI |
InChI=1/C6H4N2O5/c9-6(10)4-3-7(11)2-1-5(4)8(12)13/h1-3H,(H,9,10) |
| CAS-szám |
1078-05-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.69g/cm3 |
| Forráspont |
553.6°C at 760 mmHg |
| Törésmutató |
1.653 |
| Gyulladáspont |
288.6°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
