ChemNet > CAS > 116493-07-3 4-ciano-3-(4-metoxifenil)-5-(metiltio)tiofén-2-karbonsav
116493-07-3 4-ciano-3-(4-metoxifenil)-5-(metiltio)tiofén-2-karbonsav
| termék neve |
4-ciano-3-(4-metoxifenil)-5-(metiltio)tiofén-2-karbonsav |
| Szinonimák |
4-ciano-3-(4-metoxifenil)-5-(metil-szulfanil)tiofén-2-karbonsav |
| Angol név |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid;4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| MF |
C14H11NO3S2 |
| Molekulatömeg |
305.372 |
| InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| CAS-szám |
116493-07-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.43g/cm3 |
| Olvadáspont |
209℃ |
| Forráspont |
464.9°C at 760 mmHg |
| Törésmutató |
1.67 |
| Gyulladáspont |
234.9°C |
| Gőznyomás |
1.93E-09mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|