ChemNet > CAS > 1190-92-7 1-Dimethylamino-2-nitroethylene
1190-92-7 1-Dimethylamino-2-nitroethylene
termék neve |
1-Dimethylamino-2-nitroethylene |
Szinonimák |
1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
MF |
C4H8N2O2 |
Molekulatömeg |
116.1185 |
InChI |
InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
CAS-szám |
1190-92-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.073g/cm3 |
Forráspont |
161.1°C at 760 mmHg |
Törésmutató |
1.473 |
Gyulladáspont |
51.2°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|