ChemNet > CAS > 1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
termék neve |
2-Bromo-2',5'-dimethoxyacetophenone |
Szinonimák |
bromomethyl 2,5-dimethoxyphenyl ketone; 2-Bromo-2,5-dimethoxyacetophenone; 2-bromo-1-(2,5-dimethoxyphenyl)ethanone |
MF |
C10H11BrO3 |
Molekulatömeg |
259.0965 |
InChI |
InChI=1/C10H11BrO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5H,6H2,1-2H3 |
CAS-szám |
1204-21-3 |
EINECS |
214-873-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.422g/cm3 |
Olvadáspont |
83-88℃ |
Forráspont |
323.1°C at 760 mmHg |
Törésmutató |
1.542 |
Gyulladáspont |
149.2°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|