ChemNet > CAS > 120935-94-6 methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate
120935-94-6 methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate
termék neve |
methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate |
MF |
C8H10BrNO2 |
Molekulatömeg |
232.0745 |
InChI |
InChI=1/C8H10BrNO2/c1-4-6(8(11)12-3)7(9)5(2)10-4/h10H,1-3H3 |
CAS-szám |
120935-94-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.503g/cm3 |
Forráspont |
344.5°C at 760 mmHg |
Törésmutató |
1.558 |
Gyulladáspont |
162.2°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|