ChemNet > CAS > 14181-72-7 2-bróm-1-fenil-1-etanon-oxim
14181-72-7 2-bróm-1-fenil-1-etanon-oxim
termék neve |
2-bróm-1-fenil-1-etanon-oxim |
Szinonimák |
2-bróm-N-hidroxi-1-fenil-etanimin; (1Z)-2-bróm-1-fenil-letán-oxim |
Angol név |
2-bromo-1-phenyl-1-ethanone oxime;2-bromo-N-hydroxy-1-phenylethanimine; (1Z)-2-bromo-1-phenylethanone oxime |
MF |
C8H8BrNO |
Molekulatömeg |
214.0592 |
InChI |
InChI=1/C8H8BrNO/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H,6H2/b10-8+ |
CAS-szám |
14181-72-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.45g/cm3 |
Olvadáspont |
97℃ |
Forráspont |
296.8°C at 760 mmHg |
Törésmutató |
1.57 |
Gyulladáspont |
133.3°C |
Gőznyomás |
0.00063mmHg at 25°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|