ChemNet > CAS > 1591-98-6 4-bromo-2-methylphenyl isocyanate
1591-98-6 4-bromo-2-methylphenyl isocyanate
| termék neve |
4-bromo-2-methylphenyl isocyanate |
| Szinonimák |
4-Bromo-2-methylisocyanatobenzene; 4-bromo-1-isocyanato-2-methylbenzene |
| MF |
C8H6BrNO |
| Molekulatömeg |
212.0433 |
| InChI |
InChI=1/C8H6BrNO/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
| CAS-szám |
1591-98-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.44g/cm3 |
| Olvadáspont |
47-50℃ |
| Forráspont |
254.7°C at 760 mmHg |
| Törésmutató |
1.571 |
| Gyulladáspont |
107.9°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
