ChemNet > CAS > 2051-61-8 3-chlorobiphenyl
2051-61-8 3-chlorobiphenyl
| termék neve |
3-chlorobiphenyl |
| Szinonimák |
3-Chloro-1,1-biphenyl; 3-PCB |
| MF |
C12H9Cl |
| Molekulatömeg |
188.6529 |
| InChI |
InChI=1/C12H9Cl/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| CAS-szám |
2051-61-8 |
| EINECS |
218-126-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.131g/cm3 |
| Forráspont |
284.5°C at 760 mmHg |
| Törésmutató |
1.583 |
| Gyulladáspont |
129.5°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Biztonsági Leírás |
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
