ChemNet > CAS > 2088-24-6 3-Methoxyphenoxyacetic acid
2088-24-6 3-Methoxyphenoxyacetic acid
termék neve |
3-Methoxyphenoxyacetic acid |
Szinonimák |
Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
MF |
C9H10O4 |
Molekulatömeg |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
CAS-szám |
2088-24-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.226g/cm3 |
Forráspont |
325.9°C at 760 mmHg |
Törésmutató |
1.528 |
Gyulladáspont |
131.9°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|