ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
termék neve |
1,3-Difluoro-5-iodobenzene |
Szinonimák |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
MF |
C6H3F2I |
Molekulatömeg |
239.9893 |
InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
CAS-szám |
2265-91-0 |
Molekuláris szerkezete |
|
Sűrűség |
2.001g/cm3 |
Forráspont |
173.9°C at 760 mmHg |
Törésmutató |
1.566 |
Gyulladáspont |
63.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|