ChemNet > CAS > 23163-84-0 2-ethoxyphenyl isothiocyanate
23163-84-0 2-ethoxyphenyl isothiocyanate
| termék neve |
2-ethoxyphenyl isothiocyanate |
| Szinonimák |
o-Ethoxyphenyl isothiocyanate; 1-ethoxy-2-isothiocyanatobenzene |
| MF |
C9H9NOS |
| Molekulatömeg |
179.2389 |
| InChI |
InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| CAS-szám |
23163-84-0 |
| EINECS |
245-468-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.06g/cm3 |
| Forráspont |
293.2°C at 760 mmHg |
| Törésmutató |
1.544 |
| Gyulladáspont |
131.1°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
