ChemNet > CAS > 261762-35-0 5-Bromo-2,3-difluoroanisole
261762-35-0 5-Bromo-2,3-difluoroanisole
termék neve |
5-Bromo-2,3-difluoroanisole |
Szinonimák |
2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
MF |
C7H5BrF2O |
Molekulatömeg |
223.0148 |
InChI |
InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
CAS-szám |
261762-35-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.615g/cm3 |
Forráspont |
193.7°C at 760 mmHg |
Törésmutató |
1.5 |
Gyulladáspont |
84.6°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|