ChemNet > CAS > 2694-54-4 Triallyl Trimellitate
2694-54-4 Triallyl Trimellitate
termék neve |
Triallyl Trimellitate |
Szinonimák |
1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
MF |
C18H18O6 |
Molekulatömeg |
330.3319 |
InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
CAS-szám |
2694-54-4 |
EINECS |
220-264-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.149g/cm3 |
Forráspont |
438.1°C at 760 mmHg |
Törésmutató |
1.528 |
Gyulladáspont |
191.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|