ChemNet > CAS > 2757-23-5 chlorocarbonylsulfenyl chloride
2757-23-5 chlorocarbonylsulfenyl chloride
termék neve |
chlorocarbonylsulfenyl chloride |
Szinonimák |
Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
MF |
CCl2OS |
Molekulatömeg |
130.9811 |
InChI |
InChI=1/CCl2OS/c2-1(4)5-3 |
CAS-szám |
2757-23-5 |
EINECS |
220-415-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.66g/cm3 |
Forráspont |
98°C at 760 mmHg |
Törésmutató |
1.53 |
Gyulladáspont |
53.7°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|