ChemNet > CAS > 29418-67-5 2-Bromobenzhydrazide
29418-67-5 2-Bromobenzhydrazide
termék neve |
2-Bromobenzhydrazide |
Szinonimák |
2-Bromobenzohydrazide |
MF |
C7H7BrN2O |
Molekulatömeg |
215.0473 |
InChI |
InChI=1/C7H7BrN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS-szám |
29418-67-5 |
EINECS |
249-614-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.615g/cm3 |
Forráspont |
367.2°C at 760 mmHg |
Törésmutató |
1.615 |
Gyulladáspont |
175.9°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|