ChemNet > CAS > 343-27-1 Harmine hydrochloride hydrate
343-27-1 Harmine hydrochloride hydrate
termék neve |
Harmine hydrochloride hydrate |
Szinonimák |
7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate; Harmine hydrochlorid; Banisterine, Telepathine; 7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride; Harmine Hydrochloride |
MF |
C13H13ClN2O |
Molekulatömeg |
248.7081 |
InChI |
InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
CAS-szám |
343-27-1 |
EINECS |
206-443-8 |
Molekuláris szerkezete |
|
Olvadáspont |
265-270℃ |
Forráspont |
421.4°C at 760 mmHg |
Gyulladáspont |
139.8°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R40:Possible risks of irreversible effects.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|