ChemNet > CAS > 51362-38-0 6-phenoxynicotinic acid
51362-38-0 6-phenoxynicotinic acid
| termék neve |
6-phenoxynicotinic acid |
| Szinonimák |
6-phenoxypyridine-3-carboxylic acid |
| MF |
C12H9NO3 |
| Molekulatömeg |
215.2048 |
| InChI |
InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
| CAS-szám |
51362-38-0 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.298g/cm3 |
| Olvadáspont |
164℃ |
| Forráspont |
391.2°C at 760 mmHg |
| Törésmutató |
1.613 |
| Gyulladáspont |
190.4°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
