ChemNet > CAS > 51660-08-3 5-klór-6-fenilpiridazin-3-ol
51660-08-3 5-klór-6-fenilpiridazin-3-ol
| termék neve |
5-klór-6-fenilpiridazin-3-ol |
| Szinonimák |
5-klór-2-metil-6-fenilpiridazin-3(2H)-on; 5-klór-6-fenilpiridazin-3(2H)-on |
| Angol név |
5-chloro-6-phenylpyridazin-3-ol;5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
| MF |
C10H7ClN2O |
| Molekulatömeg |
206.6284 |
| InChI |
InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| CAS-szám |
51660-08-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.35g/cm3 |
| Olvadáspont |
235℃ |
| Forráspont |
403.2°C at 760 mmHg |
| Törésmutató |
1.641 |
| Gyulladáspont |
197.7°C |
| Gőznyomás |
4.44E-07mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|