ChemNet > CAS > 55259-49-9 Tetramethyltetraselenafulvalene
55259-49-9 Tetramethyltetraselenafulvalene
| termék neve |
Tetramethyltetraselenafulvalene |
| MF |
C10H12Se4 |
| Molekulatömeg |
448.0423 |
| InChI |
InChI=1/C10H12Se4/c1-5-6(2)12-9(11-5)10-13-7(3)8(4)14-10/h1-4H3 |
| CAS-szám |
55259-49-9 |
| Molekuláris szerkezete |
|
| Olvadáspont |
265-270℃ |
| Forráspont |
338.8°C at 760 mmHg |
| Gyulladáspont |
158.7°C |
| Veszély szimbólumok |
 T:Toxic;
|
| Kockázatot kódok |
R23/25:Toxic by inhalation and if swallowed.;
R33:Danger of cummulative effects.;
|
| Biztonsági Leírás |
S20/21:When using do not eat, drink or smoke.;
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
