ChemNet > CAS > 555-90-8 Nicothiazone
555-90-8 Nicothiazone
termék neve |
Nicothiazone |
Szinonimák |
3-Formylpyridine thiosemicarbazone; Nicotinaldehyde, thiocarbohydrazone; Nicotinaldehyde thiosemicarbazone; Pyridine-3-carboxaldehyde, thiosemicarbazone; ; 2-(pyridin-3-ylmethylidene)hydrazinecarbothioamide; pyridine-3-carbaldehyde thiosemicarbazone; Pyridine-3-aldehyde thiosemicarbazone |
MF |
C7H8N4S |
Molekulatömeg |
180.2302 |
InChI |
InChI=1/C7H8N4S/c8-7(12)11-10-5-6-2-1-3-9-4-6/h1-5H,(H3,8,11,12)/b10-5+ |
CAS-szám |
555-90-8 |
EINECS |
209-108-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.32g/cm3 |
Forráspont |
346.5°C at 760 mmHg |
Törésmutató |
1.665 |
Gyulladáspont |
163.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R25:Toxic if swallowed.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|